CAS 1909319-85-2

Pyrrolidine, 2-[(2-chlorophenyl)methyl]-2-methyl-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-[(2-chlorophenyl)methyl]-2-methyl-, hydrochloride (1:1), with the CAS number 1909319-85-2, is a chemical compound characterized by its pyrrolidine core structure, which is a five-membered saturated heterocyclic ring containing one nitrogen atom. This specific compound features a 2-chlorobenzyl group and a methyl substituent at the second position of the pyrrolidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various applications in pharmaceuticals and research. The presence of the chlorophenyl group may impart specific biological activities, potentially influencing its pharmacological profile. Additionally, the compound's molecular structure suggests it may interact with biological systems, possibly affecting neurotransmitter pathways or exhibiting other therapeutic effects. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆ClN·ClH

InChI: InChI=1S/C12H16ClN.ClH/c1-12(7-4-8-14-12)9-10-5-2-3-6-11(10)13;/h2-3,5-6,14H,4,7-9H2,1H3;1H

InChI key: InChIKey=AKJSIJZTHNNAAF-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=CC=C1)C2(C)CCCN2.Cl

Synonyms:

• Pyrrolidine, 2-[(2-chlorophenyl)methyl]-2-methyl-, hydrochloride (1:1)

2-[(2-Chlorophenyl)methyl]-2-methylpyrrolidine hydrochloride

CAS: 1909319-85-2

Versatile small molecule scaffold

Formula: C₁₂H₁₇Cl₂N

Purity: Min. 95%

Molecular weight: 246.17 g/mol

Ref: 3D-JBD31985