CAS 1909326-14-2

Ethanol, 2-[(1-methylethyl)(4-piperidinylmethyl)amino]-, hydrochloride (1:2)

Description:

Ethanol, 2-[(1-methylethyl)(4-piperidinylmethyl)amino]-, hydrochloride (1:2), identified by CAS number 1909326-14-2, is a chemical compound characterized by its complex structure that includes an ethanol backbone and a piperidine moiety. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound exhibits basic properties due to the amine group, allowing it to participate in various chemical reactions, including protonation. It may have applications in pharmaceutical research, particularly in the development of drugs targeting the central nervous system, given the presence of the piperidine ring, which is often associated with psychoactive properties. Safety data should be consulted for handling and usage, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₁H₂₄N₂O·2ClH

InChI: InChI=1S/C11H24N2O.2ClH/c1-10(2)13(7-8-14)9-11-3-5-12-6-4-11;;/h10-12,14H,3-9H2,1-2H3;2*1H

InChI key: InChIKey=OHMWRGZQPLMGBP-UHFFFAOYSA-N

SMILES: N(CC1CCNCC1)(CCO)C(C)C.Cl

Synonyms:

• Ethanol, 2-[(1-methylethyl)(4-piperidinylmethyl)amino]-, hydrochloride (1:2)

2-{[(Piperidin-4-yl)methyl](propan-2-yl)amino}ethan-1-ol dihydrochloride

CAS: 1909326-14-2

Versatile small molecule scaffold

Formula: C₁₁H₂₆Cl₂N₂O

Purity: Min. 95%

Molecular weight: 273.24 g/mol

Ref: 3D-JBD32614