CAS 1909326-20-0

4(3H)-Pyrimidinone, 3-(2-aminoethyl)-, hydrochloride (1:2)

Description:

4(3H)-Pyrimidinone, 3-(2-aminoethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring with a carbonyl group and an aminoethyl side chain. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical research. The presence of the aminoethyl group suggests potential biological activity, possibly influencing interactions with biological targets such as enzymes or receptors. The compound's molecular structure may confer properties such as basicity and the ability to form hydrogen bonds, which are crucial for its reactivity and interaction with other molecules. As a hydrochloride salt, it is likely to be stable under standard laboratory conditions, although specific handling and storage recommendations should be followed to maintain its integrity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of exploring new therapeutic agents.

Formula: C₆H₉N₃O·2ClH

InChI: InChI=1S/C6H9N3O.2ClH/c7-2-4-9-5-8-3-1-6(9)10;;/h1,3,5H,2,4,7H2;2*1H

InChI key: InChIKey=AMCNIZMFGMQUSO-UHFFFAOYSA-N

SMILES: C(CN)N1C(=O)C=CN=C1.Cl

Synonyms:

• 4(3H)-Pyrimidinone, 3-(2-aminoethyl)-, hydrochloride (1:2)

3-(2-Aminoethyl)-3,4-dihydropyrimidin-4-one dihydrochloride

CAS: 1909326-20-0

Versatile small molecule scaffold

Formula: C₆H₁₁Cl₂N₃O

Purity: Min. 95%

Molecular weight: 212.07 g/mol

Ref: 3D-JBD32620