CAS 1909327-75-8

Piperidine, 4-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a cyclobutyl group and a 1,2,4-oxadiazole moiety contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The oxadiazole ring is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the functional groups present. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₂H₁₉N₃O·ClH

InChI: InChI=1S/C12H19N3O.ClH/c1-2-10(3-1)12-14-11(16-15-12)8-9-4-6-13-7-5-9;/h9-10,13H,1-8H2;1H

InChI key: InChIKey=AXKWXTKRVKRHGV-UHFFFAOYSA-N

SMILES: C(C1=NC(=NO1)C2CCC2)C3CCNCC3.Cl

Synonyms:

• Piperidine, 4-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

4-[(3-Cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]piperidine hydrochloride

CAS: 1909327-75-8

Versatile small molecule scaffold

Formula: C₁₂H₂₀ClN₃O

Purity: Min. 95%

Molecular weight: 257.76 g/mol

Ref: 3D-JBD32775