CAS 1909327-88-3

Glycine, N-(cyclopropylmethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:

Glycine, N-(cyclopropylmethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a glycine backbone modified with a cyclopropylmethyl group and a tert-butyl ester functionality. This compound is a hydrochloride salt, indicating that it is soluble in water and likely exhibits properties typical of amino acid derivatives. The presence of the cyclopropylmethyl group may impart unique steric and electronic characteristics, potentially influencing its biological activity and interaction with receptors or enzymes. As an ester, it may be subject to hydrolysis under certain conditions, releasing glycine and the corresponding alcohol. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in pharmaceuticals or biochemical research. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-10(2,3)13-9(12)7-11-6-8-4-5-8;/h8,11H,4-7H2,1-3H3;1H

InChI key: InChIKey=NVMQDFXLAVIZOP-UHFFFAOYSA-N

SMILES: C(NCC(OC(C)(C)C)=O)C1CC1.Cl

Synonyms:

• Glycine, N-(cyclopropylmethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)

tert-Butyl 2-[(cyclopropylmethyl)amino]acetate hydrochloride

CAS: 1909327-88-3

Versatile small molecule scaffold

Formula: C₁₀H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 221.72 g/mol

Ref: 3D-JBD32788