CAS 1909335-92-7

2-Azaspiro[3.3]heptane, 1-(3-pyridinyl)-, hydrochloride (1:2)

Description:

2-Azaspiro[3.3]heptane, 1-(3-pyridinyl)-, hydrochloride (1:2) is a chemical compound characterized by its spirocyclic structure, which includes a nitrogen atom in the spiro framework. This compound features a pyridine ring, contributing to its potential biological activity and interaction with various receptors. The hydrochloride salt form indicates that it is a hydrochloride, which often enhances solubility and stability in aqueous solutions. The presence of the nitrogen atom in the azaspiro structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's molecular structure may influence its pharmacokinetics and pharmacodynamics, making it of interest in drug design. Additionally, the specific arrangement of atoms and functional groups can affect its reactivity and interactions with other chemical entities. As with many compounds containing nitrogen and aromatic systems, it may exhibit unique properties such as fluorescence or specific binding affinities, which can be explored in various research contexts.

Formula: C₁₁H₁₄N₂·2ClH

InChI: InChI=1S/C11H14N2.2ClH/c1-3-9(7-12-6-1)10-11(8-13-10)4-2-5-11;;/h1,3,6-7,10,13H,2,4-5,8H2;2*1H

InChI key: InChIKey=KRUGJCOFZWENEC-UHFFFAOYSA-N

SMILES: C12(C(NC1)C=3C=CC=NC3)CCC2.Cl

Synonyms:

• 2-Azaspiro[3.3]heptane, 1-(3-pyridinyl)-, hydrochloride (1:2)
• 1-(Pyridin-3-yl)-2-azaspiro[3.3]heptane dihydrochloride

1-(Pyridin-3-yl)-2-azaspiro[3.3]heptane dihydrochloride

CAS: 1909335-92-7

Versatile small molecule scaffold

Formula: C₁₁H₁₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 247.16 g/mol

Ref: 3D-JBD33592