CAS 1909336-06-6

1,1-Dimethylethyl N-(6-azaspiro[3.4]oct-8-ylmethyl)carbamate

Description:

1,1-Dimethylethyl N-(6-azaspiro[3.4]oct-8-ylmethyl)carbamate, identified by its CAS number 1909336-06-6, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This compound contains a spirocyclic structure, specifically a 6-azaspiro[3.4]octane moiety, which contributes to its unique three-dimensional shape and potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Such structural features suggest that this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, including melting point, boiling point, and reactivity, would require empirical data for precise evaluation, but its structural complexity indicates potential for diverse interactions in chemical and biological contexts.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-8-10-7-14-9-13(10)5-4-6-13/h10,14H,4-9H2,1-3H3,(H,15,16)

InChI key: InChIKey=JSQIERZWKALRIT-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1C2(CNC1)CCC2

Synonyms:

• 1,1-Dimethylethyl N-(6-azaspiro[3.4]oct-8-ylmethyl)carbamate
• Carbamic acid, N-(6-azaspiro[3.4]oct-8-ylmethyl)-, 1,1-dimethylethyl ester

tert-Butyl N-({6-azaspiro[3.4]octan-8-yl}methyl)carbamate

CAS: 1909336-06-6

Versatile small molecule scaffold

Formula: C₁₃H₂₄N₂O₂

Purity: Min. 95%

Molecular weight: 240.34 g/mol

Ref: 3D-JBD33606