CAS 1909336-90-8

1H-Imidazole, 5-[(2,5-difluorophenyl)methyl]-, hydrochloride (1:1)

Description:

1H-Imidazole, 5-[(2,5-difluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a 2,5-difluorophenyl group attached to the imidazole at the 5-position, contributing to its unique properties and potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, imidazole derivatives are known for their roles in medicinal chemistry, often exhibiting antifungal, antibacterial, or anticancer activities. The presence of fluorine atoms in the phenyl group can enhance lipophilicity and metabolic stability, making such compounds of interest in drug design. The specific characteristics, such as melting point, solubility, and biological activity, would depend on the compound's structure and the presence of substituents. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₁₀H₈F₂N₂·ClH

InChI: InChI=1S/C10H8F2N2.ClH/c11-8-1-2-10(12)7(3-8)4-9-5-13-6-14-9;/h1-3,5-6H,4H2,(H,13,14);1H

InChI key: InChIKey=HMSBVZGKAYIJNR-UHFFFAOYSA-N

SMILES: C(C1=C(F)C=CC(F)=C1)C2=CN=CN2.Cl

Synonyms:

• 1H-Imidazole, 5-[(2,5-difluorophenyl)methyl]-, hydrochloride (1:1)

4-[(2,5-Difluorophenyl)methyl]-1H-imidazole hydrochloride

CAS: 1909336-90-8

Versatile small molecule scaffold

Formula: C₁₀H₉ClF₂N₂

Purity: Min. 95%

Molecular weight: 230.64 g/mol

Ref: 3D-JBD33690