CAS 1909348-61-3

3-Isoxazolamine, 5-(2-thienyl)-, hydrochloride (1:1)

Description:

3-Isoxazolamine, 5-(2-thienyl)-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of the thienyl group, derived from thiophene, contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, although specific activity and mechanism of action would require further investigation. The CAS number 1909348-61-3 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Overall, the characteristics of this substance highlight its relevance in the field of drug development and organic synthesis.

Formula: C₇H₆N₂OS·ClH

InChI: InChI=1S/C7H6N2OS.ClH/c8-7-4-5(10-9-7)6-2-1-3-11-6;/h1-4H,(H2,8,9);1H

InChI key: InChIKey=NUMCMFIEIOFYFM-UHFFFAOYSA-N

SMILES: NC=1C=C(ON1)C2=CC=CS2.Cl

Synonyms:

• 3-Isoxazolamine, 5-(2-thienyl)-, hydrochloride (1:1)

5-(Thiophen-2-yl)-1,2-oxazol-3-amine hydrochloride

CAS: 1909348-61-3

Versatile small molecule scaffold

Formula: C₇H₇ClN₂OS

Purity: Min. 95%

Molecular weight: 202.66 g/mol

Ref: 3D-JBD34861