CAS 1910-63-0

2-amino-N-[2-(diethylamino)ethyl]benzamide hydrochloride (1:1)

Description:

2-amino-N-[2-(diethylamino)ethyl]benzamide hydrochloride, with the CAS number 1910-63-0, is a chemical compound characterized by its amine and amide functional groups. It features a benzamide structure, which is a derivative of benzoic acid where an amino group is substituted at the para position relative to the carbonyl group. The presence of the diethylamino group contributes to its basicity and solubility in polar solvents, making it useful in various chemical applications. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, potentially acting as a pharmacological agent, although specific biological properties would depend on its interactions within biological systems. Its synthesis and handling require standard laboratory safety protocols due to the presence of amine groups, which can be reactive. Overall, 2-amino-N-[2-(diethylamino)ethyl]benzamide hydrochloride is notable for its structural complexity and potential utility in medicinal chemistry.

Formula: C₁₃H₂₂ClN₃O

InChI: InChI=1/C13H21N3O.ClH/c1-3-16(4-2)10-9-15-13(17)11-7-5-6-8-12(11)14;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H

Tetracaine Ortho Isomer Impurity

CAS: 1910-63-0

Formula: C₁₃H₂₁N₃OHCl

Molecular weight: 235.33 : 36.46

Ref: ST-EA-CP-T54012