CAS 1910-70-9

18-hydroxy-11,17-dimethoxyyohimban-16-carboxylic acid

Description:

18-Hydroxy-11,17-dimethoxyyohimban-16-carboxylic acid, with the CAS number 1910-70-9, is a chemical compound that belongs to the class of yohimbine alkaloids, which are derived from the bark of the yohimbe tree. This compound is characterized by its complex structure, featuring a yohimbane skeleton with specific functional groups, including hydroxyl and methoxy groups, which contribute to its biological activity. It is known for its potential pharmacological effects, particularly in the context of cardiovascular health and as an aphrodisiac. The presence of the carboxylic acid group enhances its solubility in polar solvents, which can influence its bioavailability and interaction with biological systems. Additionally, the compound may exhibit various stereochemical configurations, which can affect its potency and efficacy. Research into its properties and applications continues, particularly in the fields of pharmacology and medicinal chemistry, where it may serve as a lead compound for developing new therapeutic agents.

Formula: C₂₂H₂₈N₂O₅

InChI: InChI=1/C22H28N2O5/c1-28-12-3-4-13-14-5-6-24-10-11-7-18(25)21(29-2)19(22(26)27)15(11)9-17(24)20(14)23-16(13)8-12/h3-4,8,11,15,17-19,21,23,25H,5-7,9-10H2,1-2H3,(H,26,27)

SMILES: COc1ccc2c3CCN4CC5CC(C(C(C5CC4c3[nH]c2c1)C(=O)O)OC)O

Reserpic acid hydrochloride

CAS: 1910-70-9

Reserpic acid hydrochloride is a biochemical substance.

Formula: C₂₂H₂₉ClN₂O₅

Color and Shape: Solid

Molecular weight: 436.93

Ref: TM-T34293

Reserpinic acid hydrochloride

CAS: 1910-70-9

Reserpinic acid hydrochloride is a pharmacological compound, which is an alkaloid derivative originating from the Rauwolfia species. This compound is specifically sourced from the roots of the Rauwolfia plant, which is known for its bioactive alkaloid production. The mode of action of reserpinic acid hydrochloride involves the modulation of neurotransmitters, primarily through the inhibition of the vesicular monoamine transporter (VMAT). This inhibition leads to a decrease in the storage of monoamines such as norepinephrine, serotonin, and dopamine in synaptic vesicles, resulting in their increased breakdown by monoamine oxidase and subsequent reduction in neurotransmitter levels.

Formula: C₂₂H₂₈N₂O₅·ClH

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 436.93 g/mol

Ref: 3D-FR65662

Reserpinic Acid Hydrochloride

Controlled Product

CAS: 1910-70-9

Applications Reserpinic Acid Hydrochloride is the derivative of Reserpine(R144600) which is an indole alkaloid found in Rauwolfia serpentina. Inhibits vesicular uptake of catecholamines and serotonin. Reserpine is reasonably anticipated to be a human carcinogen. Antihypertensive.
References Muller, J.M., et al.: Experientia, 8, 338 (1952), Schirmer, R.E., et al.: Anal. Profiles Drug Subs., 4, 384 (1975), Diener, R.M., et al.: Toxicol. Pathol., 8, 1 (1980),

Formula: C₂₂H₂₈N₂O₅·HCl

Color and Shape: Neat

Molecular weight: 436.929

Ref: TR-R144603