CAS 191018-57-2

2-METHYL-4-OXO-4-(3',4'-DIFLUOROPHENYL)BUTYRIC ACID

Description:

2-Methyl-4-oxo-4-(3',4'-difluorophenyl)butyric acid, identified by its CAS number 191018-57-2, is a synthetic organic compound characterized by its unique molecular structure, which includes a butyric acid backbone with a ketone and a difluorophenyl substituent. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the difluorophenyl group may enhance its lipophilicity and biological activity, while the methyl and keto groups contribute to its overall reactivity and stability. As with many organic acids, it is likely to be soluble in organic solvents and may exhibit moderate solubility in water, depending on the pH. Its specific reactivity and interactions would depend on the functional groups present, making it a candidate for further studies in medicinal chemistry or material science. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₁H₁₀F₂O₃

InChI: InChI=1/C11H10F2O3/c1-6(11(15)16)4-10(14)7-2-3-8(12)9(13)5-7/h2-3,5-6H,4H2,1H3,(H,15,16)

SMILES: CC(CC(=O)c1ccc(c(c1)F)F)C(=O)O

Synonyms:

• 2-Methyl-4-oxo-4-(3,4-difluorophenyl)Butanoicacid
• 4-(3,4-Difluorophenyl)-2-Methyl-4-Oxobutanoic Acid

4-(3,4-Difluorophenyl)-2-methyl-4-oxobutanoic acid

CAS: 191018-57-2

4-(3,4-Difluorophenyl)-2-methyl-4-oxobutanoic acid

Purity: ≥95%

Molecular weight: 228.19g/mol

Ref: 54-PC8907