CAS 19103-54-9
:Salvigenin
Description:
Salvigenin, with the CAS number 19103-54-9, is a naturally occurring flavonoid compound primarily found in various plant species. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Salvigenin exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. The compound is soluble in organic solvents and has limited solubility in water, which is typical for many flavonoids. Its chemical structure includes multiple hydroxyl groups, which enhance its reactivity and ability to scavenge free radicals. Additionally, salvigenin may interact with various biological pathways, influencing cellular processes and signaling. Research into salvigenin's therapeutic potential continues, focusing on its mechanisms of action and possible applications in health and medicine. As with many natural compounds, the extraction and purification methods can significantly affect its yield and bioactivity, highlighting the importance of careful methodological approaches in studies involving salvigenin.
Formula:C18H16O6
InChI:InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)18(23-3)17(16)20/h4-9,20H,1-3H3
InChI key:InChIKey=QCDYOIZVELGOLZ-UHFFFAOYSA-N
SMILES:OC1=C2C(OC(=CC2=O)C3=CC=C(OC)C=C3)=CC(OC)=C1OC
Synonyms:- 4H-1-Benzopyran-4-one, 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-
- 5-Desmethyltetraraethylscutellarein
- 5-Hydroxy-4′,6,7-trimethoxyflavone
- 5-Hydroxy-6,7,4'-trimethoxyflavone
- 5-Hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
- 7-O-Methylpectolinarigenin
- Flavone, 5-hydroxy-4′,6,7-trimethoxy-
- Psathyrotin
- Salvigenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
4H-1-Benzopyran-4-one, 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-
CAS:Formula:C18H16O6Purity:98%Color and Shape:SolidMolecular weight:328.3160Salvigenin
CAS:Salvigenin is a potent hMAO-A inhibitor, has neuroprotective, antitumor and immunomodulatory effects.Formula:C18H16O6Purity:99.17% - 99.78%Color and Shape:SolidMolecular weight:328.32Salvigenin
CAS:<p>Salvigenin is a flavone compound, which is found in various species of the Salvia plant. It is a naturally occurring phytochemical characterized by its potential to modulate biological pathways. Salvigenin primarily acts by interacting with biochemical pathways, exhibiting antioxidant and anti-inflammatory activities. These activities are thought to result from its ability to modulate enzyme activity, influence signaling pathways, and scavenge free radicals.</p>Formula:C18H16O6Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:328.32 g/mol







