CAS 191090-36-5

(S)-(-)-5,5-DIPHENYL-4-(TERT-BUTYL)-2-OXAZOLIDINONE

Description:

(S)-(-)-5,5-Diphenyl-4-(tert-butyl)-2-oxazolidinone is a chiral oxazolidinone compound characterized by its unique structural features, including a five-membered ring containing an oxygen and nitrogen atom. This compound exhibits a high degree of stereochemical specificity due to the presence of the chiral center, which contributes to its potential applications in asymmetric synthesis and as a chiral auxiliary in organic reactions. The diphenyl and tert-butyl groups enhance its steric bulk and lipophilicity, influencing its solubility and reactivity. Additionally, oxazolidinones are known for their role in medicinal chemistry, particularly in the development of antibiotics and other therapeutic agents. The compound's stability, reactivity, and ability to participate in various chemical transformations make it a valuable intermediate in synthetic organic chemistry. Its CAS number, 191090-36-5, allows for easy identification and retrieval of information related to its properties and applications in scientific literature and databases.

Formula: C₁₉H₂₁NO₂

InChI: InChI=1/C19H21NO2/c1-18(2,3)16-19(22-17(21)20-16,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16H,1-3H3,(H,20,21)/t16-/m0/s1

SMILES: CC(C)(C)[C@H]1C(c2ccccc2)(c2ccccc2)OC(=N1)O

Synonyms:

• (S)-4-(-)-(Tert-Butyl)-5,5-Diphenyl-2-Oxazolidinone
• (4S)-4-tert-butyl-5,5-diphenyl-1,3-oxazolidin-2-one

2-Oxazolidinone, 4-(1,1-dimethylethyl)-5,5-diphenyl-, (4S)-

CAS: 191090-36-5

Formula: C₁₉H₂₁NO₂

Molecular weight: 295.3755

Ref: IN-DA002F1E

(S)-4-(-)-(tert-Butyl)-5,5-diphenyl-2-oxazolidinone

CAS: 191090-36-5

(S)-4-(-)-(tert-Butyl)-5,5-diphenyl-2-oxazolidinone

Purity: ≥95%

Molecular weight: 295.38g/mol

Ref: 54-OR304037