CAS 1911-78-0

Oplopanone

Description:

Oplopanone is a chemical compound classified as a sesquiterpene, primarily derived from various plant sources, particularly those in the Asteraceae family. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties. Oplopanone is known for its potential biological activities, including anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. The compound has a relatively low molecular weight and exhibits moderate solubility in organic solvents, which is typical for many terpenes. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, contributing to its reactivity and interaction with other substances. Additionally, oplopanone's presence in essential oils and its role in plant defense mechanisms highlight its ecological significance. As research continues, the exploration of oplopanone's applications in medicine and industry may reveal further insights into its utility and benefits.

Formula: C₁₅H₂₆O₂

InChI: InChI=1S/C15H26O2/c1-9(2)11-7-8-15(4,17)13-6-5-12(10(3)16)14(11)13/h9,11-14,17H,5-8H2,1-4H3/t11-,12+,13+,14+,15+/m0/s1

InChI key: InChIKey=WLXJHVQYKOJBBN-NJVJYBDUSA-N

SMILES: C(C)(=O)[C@@H]1[C@@]2([C@@](CC1)([C@](C)(O)CC[C@H]2C(C)C)[H])[H]

Synonyms:

• (1S,3aα,7aβ)-1-Acetyloctahydro-4α-hydroxy-7β-isopropyl 4-methyl-1H-indene
• 1-[[(1S,3aα,7aβ)-Octahydro-4β-hydroxy-4-methyl-7β-isopropyl-1H-inden]-1-yl]ethanone
• 10alpha-Hydroxyoplopan-4-one
• Oplopane
• Ethanone, 1-[(1S,3aR,4R,7S,7aS)-octahydro-4-hydroxy-4-methyl-7-(1-methylethyl)-1H-inden-1-yl]-

Oplopanone

CAS: 1911-78-0

Oplopanone exhibits noteworthy anti-plasmodial activity against Plasmodium falciparum strain.

Formula: C₁₅H₂₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.37

Ref: TM-TN4717

Oplopanone

CAS: 1911-78-0

Formula: C₁₅H₂₆O₂

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 238.371

Ref: BP-SBP01083

Oplopanone

CAS: 1911-78-0

Oplopanone is a sesquiterpenoid, which is a naturally occurring organic compound, commonly found in the plant species Oplopanax elatus. This compound is part of the complex chemical arsenal produced by plants, often derived from terpenoid biosynthetic pathways. Oplopanone functions primarily through mechanisms involving modulation of cell signaling pathways, and it exhibits various biological activities at the molecular level.

Formula: C₁₅H₂₆O₂

Purity: Min. 95%

Molecular weight: 238.37 g/mol

Ref: 3D-BAA91178