CAS 19116-90-6
:2,5-Dimethoxybenzenesulfonamide
Description:
2,5-Dimethoxybenzenesulfonamide is an organic compound characterized by its sulfonamide functional group attached to a dimethoxy-substituted benzene ring. The presence of two methoxy groups at the 2 and 5 positions of the benzene ring enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound typically appears as a white to off-white solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The sulfonamide group contributes to its ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Additionally, 2,5-Dimethoxybenzenesulfonamide may exhibit various properties such as moderate stability under standard conditions, and it may be sensitive to strong acids or bases. Its molecular structure allows for potential modifications that can lead to derivatives with varied pharmacological properties. As with many sulfonamides, it is important to handle this compound with care, considering potential toxicity and environmental impact.
Formula:C8H11NO4S
InChI:InChI=1S/C8H11NO4S/c1-12-6-3-4-7(13-2)8(5-6)14(9,10)11/h3-5H,1-2H3,(H2,9,10,11)
InChI key:InChIKey=MMHMYFWOECSGDR-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(OC)C=CC(OC)=C1
Synonyms:- 2,5-Dimethoxy-benzenesulfonic acid amide
- 2,5-Dimethoxybenzenesulfonamide
- Ai3-17891
- Benzenesulfonamide, 2,5-dimethoxy-
- Brn 2648546
- 2,5-Dimethoxybenzene-1-sulfonamide
- 3-11-00-00570 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Dimethoxybenzenesulphonamide
CAS:2,5-DimethoxybenzenesulphonamideFormula:C8H11NO4SPurity:≥95%Color and Shape: white crystalline solidMolecular weight:217.24g/mol2,5-Dimethoxybenzenesulfonamide
CAS:Formula:C8H11NO4SPurity:97.0%Color and Shape:SolidMolecular weight:217.242,5-Dimethoxybenzenesulfonamide
CAS:<p>2,5-Dimethoxybenzenesulfonamide is a piperidine derivative that has been shown to be an efficient electrophile. 2,5-Dimethoxybenzenesulfonamide reacts with protonated metal surfaces, forming a monolayer of high surface area and low coverage. The affinity of this compound for the metal surface is due to its nucleophilic nature. This compound displays a strong adsorption to the metal surface and provides protection from corrosion by acting as an oxygen scavenger. Experimental results have shown that 2,5-dimethoxybenzenesulfonamide exhibits higher efficiencies in the presence of other reactive compounds.<br>2,5-Dimethoxybenzenesulfonamide was used in computational simulations to study the effects of different parameters on the adsorption process. The use of these simulations can provide insight into how changes in experimental conditions affect the efficiency of this molecule.</p>Formula:C8H11NO4SPurity:Min. 95%Molecular weight:217.24 g/mol



