CAS 1912-45-4
:5-Chloroindole-3-acetic acid
Description:
5-Chloroindole-3-acetic acid (CAS 1912-45-4) is a synthetic compound that belongs to the class of indole derivatives, which are known for their diverse biological activities. This substance features a chloro substituent at the 5-position of the indole ring and an acetic acid functional group at the 3-position, contributing to its unique chemical properties. It is typically characterized by its solid state at room temperature and is soluble in polar solvents such as water and alcohols, which facilitates its use in various biochemical applications. 5-Chloroindole-3-acetic acid is primarily recognized for its role as a plant growth regulator, influencing processes such as cell elongation and differentiation. Additionally, it has been studied for its potential effects on various physiological processes in plants and may exhibit herbicidal properties. Its structural features allow it to interact with plant hormone pathways, making it a valuable compound in agricultural and horticultural research. As with many chemical substances, proper handling and safety precautions are essential when working with this compound.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14)
InChI key:InChIKey=ZEIRLSDFVXNFGG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(NC1)=CC=C(Cl)C2
Synonyms:- (5-chloro-1H-indol-3-yl)acetic acid
- 1H-Indole-3-acetic acid, 5-chloro-
- 2-(5-Chloro-1H-indol-3-yl)acetic acid
- 2-(5-Chloroindol-1H-3-Yl)Acetic Acid
- 5-Chloro-1H-indole-3-acetic acid
- 5-Chloro-Iaa
- 5-Chloroindole-3-Acetic Acid 98% (Hplc)
- 5-Chloroindoleacetic acid
- 5-Cl-IAA
- Indole-3-acetic acid, 5-chloro-
- Rarechem Ah Bs 0086
- Sr 024
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-3-acetic acid, 5-chloro-
CAS:Formula:C10H8ClNO2Purity:97%Color and Shape:SolidMolecular weight:209.62905-Chloroindole-3-acetic acid
CAS:5-Chloroindole-3-acetic acidFormula:H2Purity:97%Color and Shape: off-white crystalline powderMolecular weight:209.63g/mol5-Chloroindole-3-acetic acid
CAS:5-Chloroindole-3-acetic acid (5CI3A) is a compound that belongs to the indole class of compounds. It is structurally similar to the amino acid tryptophan, which makes it a good template molecule for the synthesis of other indoles. 5CI3A is mainly found in plants and bacteria, where it acts as an auxin. In plants, 5CI3A stimulates cell elongation and leaf growth by interacting with plant hormones such as auxins and gibberellins. This compound also binds to serum albumin, which may be responsible for its low toxicity in humans. 5CI3A has been shown to inhibit the activity of human serum albumin by forming hydrogen bonds with it. This inhibition reduces the binding affinity of 5CI3A for other proteins in serum, making it less likely to interact with them than if there were no binding competition.Formula:C10H8ClNO2Color and Shape:PowderMolecular weight:209.63 g/mol2-(5-Chloro-1H-indol-3-yl)acetic acid
CAS:Formula:C10H8ClNO2Purity:97%Color and Shape:SolidMolecular weight:209.63



