CAS 1912-48-7
:1-methyl-3-indoleacetic acid
Description:
1-Methyl-3-indoleacetic acid, commonly referred to as 1-Methylindole-3-acetic acid (MIA), is a naturally occurring plant hormone belonging to the class of auxins. It plays a crucial role in regulating various physiological processes in plants, including cell elongation, root formation, and response to light and gravity. The chemical structure of MIA features an indole ring, which is characteristic of many auxins, and a methyl group that distinguishes it from other indoleacetic acids. MIA is typically a white to off-white crystalline solid, and it is soluble in organic solvents but has limited solubility in water. Its biological activity is influenced by its concentration and the specific plant species, making it an important compound in agricultural and horticultural applications. Additionally, research into MIA has explored its potential effects on plant growth and development, as well as its interactions with other phytohormones. Overall, 1-methyl-3-indoleacetic acid is significant in both plant physiology and agricultural practices.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-12-7-8(6-11(13)14)9-4-2-3-5-10(9)12/h2-5,7H,6H2,1H3,(H,13,14)
SMILES:Cn1cc(CC(=O)O)c2ccccc12
Synonyms:- (1-methyl-1H-indol-3-yl)acetic acid
- 2-(1-methyl-1H-indol-3-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Indole-3-acetic acid, 1-methyl-
CAS:Formula:C11H11NO2Purity:95%Color and Shape:SolidMolecular weight:189.21052-(1-Methyl-1H-indol-3-yl)acetic acid
CAS:2-(1-Methyl-1H-indol-3-yl)acetic acidPurity:95%Molecular weight:189.21g/mol1-Methyl-3-indoleacetic acid
CAS:Formula:C11H11NO2Purity:95%Color and Shape:Off-white crystalline powderMolecular weight:189.2141-Methylindole-3-acetic Acid
CAS:Controlled ProductApplications 1-Methylindole-3-acetic Acid is a N-methylated derivative of Indole-3-acetic acid, a natural auxin, with plant growth regulating activity.
References Furukawa, S. et al.: J. Toxicol. Sci., 30, 165 (2005); Chamberlain, K. et al.:: Ann. Appl. Toxicol., 75, 409 (1973);Formula:C11H11NO2Color and Shape:NeatMolecular weight:189.211-Methylindole-3-acetic acid
CAS:Controlled Product1-Methylindole-3-acetic acid is a biologically active compound that has been used as a medicine. It can be synthesized by the oxidation of 1-methylindole with trifluoroacetic acid and 3-bromopropylamine hydrobromide. The reaction produces a radical species that reacts with dioxetanes to form linear plots. 1-Methylindole-3-acetic acid is also susceptible to light, which leads to the formation of peroxy dioxetanes, amides, and protonated derivatives. The biological relevance is not yet known.Formula:C11H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:189.21 g/mol





