CAS 191228-04-3

Heptanamide, 7-[(4'-cyano[1,1'-biphenyl]-4-yl)oxy]-N-hydroxy-

Description:

Heptanamide, 7-[(4'-cyano[1,1'-biphenyl]-4-yl)oxy]-N-hydroxy- is an organic compound characterized by its amide functional group and a long hydrocarbon chain. The presence of a heptanamide structure indicates that it has a seven-carbon alkyl chain, which contributes to its hydrophobic properties. The compound also features a hydroxyl group (N-hydroxy), which can enhance its solubility in polar solvents and may influence its reactivity. The cyano group attached to a biphenyl moiety suggests potential applications in materials science or pharmaceuticals, as cyano-substituted compounds often exhibit interesting electronic properties. The biphenyl structure can provide rigidity and stability to the molecule, while the overall architecture may allow for specific interactions in biological systems or in synthetic applications. This compound's unique combination of hydrophobic and hydrophilic characteristics, along with its functional groups, makes it a candidate for various chemical and biological applications, including drug development and as a potential building block in organic synthesis.

Formula: C₂₀H₂₂N₂O₃

InChI: InChI=1/C20H22N2O3/c21-15-16-6-8-17(9-7-16)18-10-12-19(13-11-18)25-14-4-2-1-3-5-20(23)22-24/h6-13,24H,1-5,14H2,(H,22,23)

SMILES: C(CCCOc1ccc(cc1)c1ccc(cc1)C#N)CCC(=NO)O

Synonyms:

• 7-[(4'-cyanobiphenyl-4-yl)oxy]-N-hydroxyheptanamide
• Heptanamide, 7-[(4'-cyano[1,1'-biphenyl]-4-yl)oxy]-N-hydroxy-

7-((4'-Cyano-[1,1'-biphenyl]-4-yl)oxy)-N-hydroxyheptanamide

CAS: 191228-04-3

Formula: C₂₀H₂₂N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 338.4003

Ref: IN-DA002F4R