CAS 191282-49-2

CIS-TETRAHYDRO-3-METHYLENE-2-OXO-5-N-OCTYL-4-FURANCARBOXYLIC ACID

Description:

Cis-tetrahydro-3-methylene-2-oxo-5-n-octyl-4-furancarboxylic acid is a chemical compound characterized by its unique furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated form of the furan. The presence of a carboxylic acid functional group (-COOH) contributes to its acidity and potential reactivity in various chemical processes. The n-octyl side chain enhances its hydrophobic properties, making it more soluble in organic solvents than in water. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest it could participate in various chemical reactions, including esterification and amidation. Overall, the characteristics of cis-tetrahydro-3-methylene-2-oxo-5-n-octyl-4-furancarboxylic acid make it a compound of interest in both synthetic organic chemistry and potential applications in medicinal chemistry.

Formula: C₁₄H₂₂O₄

InChI: InChI=1/C14H22O4/c1-3-4-5-6-7-8-9-11-12(13(15)16)10(2)14(17)18-11/h11-12H,2-9H2,1H3,(H,15,16)/t11-,12-/m1/s1

Synonyms:

• (2R,3R)-4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid
• 3-furancarboxylic acid, tetrahydro-4-methylene-2-octyl-5-oxo-, (2R,3R)-
• cis-Tetrahydro-3-methylene-2-oxo-5-n-octyl-4-furancarboxylic acid
• (2R,3R)-4-Methylene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid

Cis-C75

CAS: 191282-49-2

Cis-C75 is a five-membered oxygen-containing heterocyclic derivative containing a carboxylic acid group,

Formula: C₁₄H₂₂O₄

Purity: 98.25%

Color and Shape: Soild

Molecular weight: 254.32

Ref: TM-T10657L

Cis-C75

CAS: 191282-49-2

Cis-C75

Purity: ≥98%

Molecular weight: 254.32g/mol

Ref: 54-BUP22140