CAS 19132-98-0

4-DIMETHYLAMINO-4'-METHYLCHALCONE

Description:

4-Dimethylamino-4'-methylchalcone is an organic compound belonging to the chalcone class, characterized by its structure that includes a chalcone backbone with dimethylamino and methyl substituents. This compound typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond systems that allow for light absorption in the visible spectrum. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The presence of the dimethylamino group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Additionally, 4-dimethylamino-4'-methylchalcone can participate in various chemical reactions, such as oxidation and reduction, due to the presence of reactive functional groups. Its synthesis often involves the condensation of appropriate aldehydes and ketones under basic conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₈H₁₉NO

InChI: InChI=1/C18H19NO/c1-14-4-9-16(10-5-14)18(20)13-8-15-6-11-17(12-7-15)19(2)3/h4-13H,1-3H3

SMILES: Cc1ccc(cc1)C(=O)C=Cc1ccc(cc1)N(C)C

Synonyms:

• Omega-(P-Dimethylaminobenzylidene)-4-Methyl Acetophenone
• 3-[4-(Dimethylamino)Phenyl]-1-(4-Methylphenyl)Prop-2-En-1-One

4-Dimethylamino-4'-methylchalcone

CAS: 19132-98-0

4-Dimethylamino-4'-methylchalcone is a versatile building block that can be used in synthesis of fine chemicals, research chemicals, and reagents. It can also be used as a speciality chemical or useful intermediate for the preparation of other compounds. 4-Dimethylamino-4'-methylchalcone has been shown to react with many different functional groups and is useful as a scaffold for the synthesis of complex molecules. It has been shown to have high quality, making it an excellent choice for use in reactions.

Formula: C₁₈H₁₉NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 265.35 g/mol

Ref: 3D-FD69798