CymitQuimica logo

CAS 191327-28-3

:

(R)-1,2,3,4-Tetrahydro-3-Isoquinolinecarboxylic Acid Methyl Ester

Description:
(R)-1,2,3,4-Tetrahydro-3-Isoquinolinecarboxylic Acid Methyl Ester, with the CAS number 191327-28-3, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This compound features a tetrahydroisoquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated structure. The presence of a carboxylic acid methyl ester functional group suggests that it can participate in various chemical reactions, such as esterification and hydrolysis. The (R) configuration denotes the specific stereochemistry of the molecule, which can influence its biological activity and interactions. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active molecules. Additionally, its solubility and reactivity can be influenced by the ester group, making it a potential candidate for further chemical modifications or applications in drug design.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c1-14-11(13)10-6-8-4-2-3-5-9(8)7-12-10/h2-5,10,12H,6-7H2,1H3
InChI key:YTNGWXICCHJHKA-SNVBAGLBSA-N
SMILES:COC(=O)C1Cc2ccccc2CN1
Synonyms:
  • Methyl 1,2,3,4-Tetrahydro-Isoquinoline-3(R)-Carboxylate
  • (R)-1,2,3,4-Tetrahydro-Isoquinoline-3-Carboxylic Acid Methyl Ester
  • (R)-methyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate
Found 3 products.