CAS 191327-29-4

3H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

3H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes an imidazole and pyridine ring fused together. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents due to the presence of the carboxylic acid functional group. The hydrochloride salt form indicates that it is a protonated version of the base, enhancing its stability and solubility in aqueous solutions. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, including antimicrobial or anti-inflammatory activities. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cyclizations, which can be exploited in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₇H₉N₃O₂·ClH

InChI: InChI=1S/C7H9N3O2.ClH/c11-7(12)5-1-4-6(2-8-5)10-3-9-4;/h3,5,8H,1-2H2,(H,9,10)(H,11,12);1H

InChI key: InChIKey=IJWPDVGZOCCGRA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2=C(CN1)N=CN2.Cl

Synonyms:

• 1H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-, monohydrochloride
• 3H-Imidazo[4,5-c]pyridine-6-carboxylic acid, 4,5,6,7-tetrahydro-, hydrochloride (1:1)
• 1H,4H,5H,6H,7H-Imidazo[4,5-c]pyridine-6-carboxylic acid hydrochloride

4,5,6,7-Tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid hydrochloride

CAS: 191327-29-4

Versatile small molecule scaffold

Formula: C₇H₁₀ClN₃O₂

Purity: Min. 95%

Molecular weight: 203.62 g/mol

Ref: 3D-RHA32729