CymitQuimica logo

CAS 191348-04-6

:

(S)-tert-butyl 3-formylpyrrolidine-1-carboxylate

Description:
(S)-tert-butyl 3-formylpyrrolidine-1-carboxylate is a chiral compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a tert-butyl group enhances its hydrophobic properties, while the formyl and carboxylate functional groups contribute to its reactivity and potential for forming hydrogen bonds. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules due to its ability to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Its chirality indicates that it exists in two enantiomeric forms, with the (S) configuration being of particular interest in asymmetric synthesis. The compound's solubility and stability can vary depending on the solvent and conditions used, making it important to consider these factors in practical applications. Overall, (S)-tert-butyl 3-formylpyrrolidine-1-carboxylate is a versatile building block in medicinal chemistry and organic synthesis.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-5-4-8(6-11)7-12/h7-8H,4-6H2,1-3H3/t8-/m0/s1
InChI key:DWLADVOODHZCFV-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N1CC[C@@H](C1)C=O
Synonyms:
  • (3S)-3-Formyl-1-pyrrolidinecarboxylic acid tert-butyl ester
Found 4 products.