CAS 191348-14-8

2-IODO-4-METHOXYPHENYLAMINE

Description:

2-Iodo-4-methoxyphenylamine is an organic compound characterized by the presence of an iodine atom and a methoxy group attached to a phenylamine structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and iodine, reflecting its aromatic nature and functional groups. The methoxy group (-OCH3) enhances the compound's solubility in organic solvents and can influence its reactivity and biological activity. The iodine substituent can impart unique properties, such as increased lipophilicity and potential for halogen bonding. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, its structure suggests potential applications in organic synthesis and materials science. As with many halogenated compounds, considerations regarding toxicity and environmental impact are important, particularly in terms of handling and disposal. Overall, 2-iodo-4-methoxyphenylamine represents a versatile building block in organic synthesis with potential applications in various fields.

Formula: C₇H₈INO

InChI: InChI=1/C7H8INO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3

SMILES: COc1ccc(c(c1)I)N

Synonyms:

• 2-Iodo-4-Methoxyaniline
• 4-Amino-3-iodoanisole

Benzenamine, 2-iodo-4-methoxy-

CAS: 191348-14-8

Formula: C₇H₈INO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 249.0490

Ref: IN-DA002F5Z

2-Iodo-4-methoxyaniline

CAS: 191348-14-8

2-Iodo-4-methoxyaniline

Formula: C₇H₈INO

Purity: 95%

Color and Shape: brown to black liquid

Molecular weight: 249.05g/mol

Ref: 54-OR400551

2-Iodo-4-Methoxy-Aniline

CAS: 191348-14-8

Formula: C₇H₈INO

Molecular weight: 249.05

Ref: 4Z-A-248050

2-Iodo-4-methoxyphenylamine

CAS: 191348-14-8

Formula: C₇H₈INO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 249.051

Ref: 10-F079758