CAS 19140-19-3
:Di-t-butyltin oxide
Description:
Di-t-butyltin oxide, with the CAS number 19140-19-3, is an organotin compound characterized by its two t-butyl groups bonded to a tin atom, along with an oxide functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its stability and low volatility. Di-t-butyltin oxide is primarily utilized as a catalyst in various polymerization processes, particularly in the production of polyurethanes and silicones. It exhibits moderate toxicity and can pose environmental hazards, necessitating careful handling and disposal. The compound is also recognized for its ability to act as a stabilizer in PVC formulations, enhancing the material's durability and resistance to degradation. Additionally, di-t-butyltin oxide can participate in various chemical reactions, including those involving nucleophiles, due to the presence of the tin-oxygen bond. Its applications extend to the field of biocides, where it is used to control microbial growth in industrial settings. Overall, di-t-butyltin oxide is a versatile compound with significant industrial relevance.
Formula:C8H18OSn
InChI:InChI=1/2C4H9.O.Sn/c2*1-4(2)3;;/h2*1-3H3;;/rC8H18OSn/c1-7(2,3)10(9)8(4,5)6/h1-6H3
SMILES:CC(C)(C)[Sn](=O)C(C)(C)C
Synonyms:- Di-Tert-Butyl(Oxo)Stannane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
