CAS 191419-07-5

Pyridine, 2,3-dichloro-4-methyl- (9CI)

Description:

Pyridine, 2,3-dichloro-4-methyl- (9CI), with the CAS number 191419-07-5, is a chlorinated derivative of pyridine, a heterocyclic aromatic compound. This substance features a six-membered ring containing one nitrogen atom and exhibits a distinctive aromatic character. The presence of two chlorine atoms at the 2 and 3 positions, along with a methyl group at the 4 position, contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid with a characteristic odor. This compound is known for its potential applications in organic synthesis, particularly in the production of agrochemicals and pharmaceuticals. Its reactivity is influenced by the electron-withdrawing nature of the chlorine substituents, which can affect nucleophilic attack and other chemical interactions. Additionally, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 2,3-dichloro-4-methylpyridine is a valuable compound in various chemical processes, with specific applications guided by its structural characteristics.

Formula: C₆H₅Cl₂N

InChI: InChI=1/C6H5Cl2N/c1-4-2-3-9-6(8)5(4)7/h2-3H,1H3

SMILES: Cc1ccnc(c1Cl)Cl

Synonyms:

• 2,3-Dichloro-4-Picoline
• 2,3-Dichloro-4-Methylpyridine

2,3-Dichloro-4-picoline

CAS: 191419-07-5

Formula: C₆H₅Cl₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.0166

Ref: IN-DA002F8D

2,3-Dichloro-4-methylpyridine

CAS: 191419-07-5

2,3-Dichloro-4-methylpyridine

Purity: 98%

Molecular weight: 162.02g/mol

Ref: 54-OR315082

2,3-Dichloro-4-methylpyridine

CAS: 191419-07-5

Formula: C₆H₅Cl₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.01

Ref: 10-F329706