
CAS 19147-35-4
:Ethanaminium, N,N-diethyl-2-hydroxy-N-methyl-, chloride (1:1)
Description:
Ethanaminium, N,N-diethyl-2-hydroxy-N-methyl-, chloride (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its structure that includes a central nitrogen atom bonded to two ethyl groups, a hydroxy group, and a methyl group. This compound typically appears as a white crystalline solid or a viscous liquid, depending on its specific formulation and purity. It is soluble in water and various organic solvents, which enhances its utility in different applications. The presence of the hydroxy group contributes to its potential as a surfactant and antimicrobial agent, making it valuable in pharmaceutical and industrial formulations. Additionally, its quaternary ammonium nature imparts cationic properties, allowing it to interact with anionic species, which can be beneficial in various chemical processes. Safety data indicates that, like many quaternary ammonium compounds, it should be handled with care due to potential irritant effects on skin and eyes. Overall, this compound's unique structure and properties make it significant in both research and practical applications.
Formula:C7H18NO·Cl
InChI:InChI=1S/C7H18NO.ClH/c1-4-8(3,5-2)6-7-9;/h9H,4-7H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=JIJBLHYYNVNUFF-UHFFFAOYSA-M
SMILES:[N+](CCO)(CC)(CC)C.[Cl-]
Synonyms:- Ammonium, diethyl(2-hydroxyethyl)methyl-, chloride
- Ethanaminium, N,N-diethyl-2-hydroxy-N-methyl-, chloride
- Ethanaminium, N,N-diethyl-2-hydroxy-N-methyl-, chloride (1:1)
- Diethyl(2-hydroxyethyl)methylammonium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanaminium, N,N-diethyl-2-hydroxy-N-methyl-, chloride (1:1)
CAS:Formula:C7H18ClNOMolecular weight:167.6769
