CAS 191471-52-0

(1R,4R,5S,6R)-4-Amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid

Description:

(1R,4R,5S,6R)-4-Amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid, with CAS number 191471-52-0, is a bicyclic compound characterized by its unique structural features, including a bicyclo[3.1.0] framework and multiple functional groups. This compound contains two carboxylic acid groups, which contribute to its acidity and potential for forming salts or esters. The presence of an amino group enhances its reactivity and solubility in polar solvents, making it suitable for various biochemical applications. The stereochemistry indicated by the (1R,4R,5S,6R) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions with other molecules. This compound may serve as a building block in organic synthesis or as a potential pharmaceutical agent, given its structural complexity and functional diversity. Its properties, such as melting point, solubility, and reactivity, would be influenced by the presence of these functional groups and the overall molecular conformation.

Formula: C₇H₉NO₅

InChI: InChI=1S/C7H9NO5/c8-7(6(11)12)1-13-4-2(3(4)7)5(9)10/h2-4H,1,8H2,(H,9,10)(H,11,12)/t2-,3-,4+,7+/m1/s1

InChI key: InChIKey=YASVRZWVUGJELU-MDASVERJSA-N

SMILES: C(O)(=O)[C@@]1(N)[C@@]2([C@@H](C(O)=O)[C@@]2(OC1)[H])[H]

Synonyms:

• 2-Oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid, 4-amino-, (1R,4R,5S,6R)-
• 2-Oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid, 4-amino-, [1R-(1α,4β,5α,6α)]-
• Ly-379268
• (1R,4R,5S,6R)-4-Amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid

2-Oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid, 4-amino-, (1R,4R,5S,6R)-

CAS: 191471-52-0

Formula: C₇H₉NO₅

Purity: 99%

Molecular weight: 187.1501

Ref: IN-DA002F9L

LY 379268

Controlled Product

CAS: 191471-52-0

Formula: C₇H₉NO₅

Color and Shape: Neat

Molecular weight: 187.15

Ref: TR-L486720

LY 379268

CAS: 191471-52-0

Agonist of metabotropic glutamate receptors (mGluR2/3)

Formula: C₇H₉NO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 187.15 g/mol

Ref: 3D-FA146399