
CAS 19149-54-3
:N-(1-Carboxyethyl)-L-alanine
Description:
N-(1-Carboxyethyl)-L-alanine, also known as L-α-carboxyethylalanine, is an amino acid derivative characterized by its structure, which includes both an amino group and a carboxylic acid group, making it a zwitterionic compound. This substance is typically found in biological systems and is involved in various metabolic pathways. It is soluble in water due to its polar functional groups, which enhances its reactivity and interaction with other biomolecules. The compound is often studied for its potential roles in nutrition and biochemistry, particularly in relation to protein synthesis and metabolic regulation. Its CAS number, 19149-54-3, uniquely identifies it in chemical databases, facilitating research and application in fields such as pharmaceuticals and biochemistry. As with many amino acids, it may exhibit optical activity, existing in different enantiomeric forms, with the L-form being biologically relevant. Overall, N-(1-Carboxyethyl)-L-alanine is significant in both scientific research and potential therapeutic applications.
Formula:C6H11NO4
InChI:InChI=1S/C6H11NO4/c1-3(5(8)9)7-4(2)6(10)11/h3-4,7H,1-2H3,(H,8,9)(H,10,11)/t3-,4?/m0/s1
InChI key:InChIKey=FIOHTMQGSFVHEZ-WUCPZUCCSA-N
SMILES:C(N[C@H](C(O)=O)C)(C(O)=O)C
Synonyms:- (S)-α,α′-Iminodipropionic acid
- L-Alanine, N-(1-carboxyethyl)-
- N-(1-Carboxyethyl)-L-alanine
- 2-[[(1S)-1-Carboxyethyl]amino]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

