CAS 1914945-67-7
:1-Oxa-4,9-diazaspiro[5.5]undecan-5-one
Description:
1-Oxa-4,9-diazaspiro[5.5]undecan-5-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its framework. The compound features a spiro connection between two rings, contributing to its rigidity and potential biological activity. The presence of the oxo group (C=O) and the diaza moieties (two nitrogen atoms) suggests that it may exhibit interesting chemical reactivity and properties, such as potential coordination with metal ions or participation in various organic reactions. Its structural complexity may also influence its solubility, stability, and interaction with biological systems. Compounds of this nature are often investigated for their pharmacological properties, including antimicrobial or anticancer activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, 1-Oxa-4,9-diazaspiro[5.5]undecan-5-one represents a class of compounds that may have significant implications in medicinal chemistry and materials science.
Formula:C8H14N2O2
InChI:InChI=1S/C8H14N2O2/c11-7-8(12-6-5-10-7)1-3-9-4-2-8/h9H,1-6H2,(H,10,11)
InChI key:InChIKey=ORHWCQDLPRLEEU-UHFFFAOYSA-N
SMILES:O=C1C2(CCNCC2)OCCN1
Synonyms:- 1-Oxa-4,9-diazaspiro[5.5]undecan-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Oxa-4,9-diazaspiro[5.5]undecan-5-one
CAS:Controlled ProductFormula:C8H14N2O2Color and Shape:NeatMolecular weight:170.209
