CAS 1915-41-9
:N-3-Pyridinyl-3-pyridinamine
Description:
N-3-Pyridinyl-3-pyridinamine, with the CAS number 1915-41-9, is an organic compound characterized by its dual pyridine rings, which contribute to its aromatic properties and potential biological activity. This compound features an amine functional group, which can participate in hydrogen bonding and may influence its solubility and reactivity. The presence of the pyridinyl groups suggests that it may exhibit basic properties, allowing it to interact with various biological targets. N-3-Pyridinyl-3-pyridinamine is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to other biologically active compounds. Its molecular structure may also allow for various substitution reactions, making it a versatile building block in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, N-3-Pyridinyl-3-pyridinamine represents a significant compound in the field of organic and medicinal chemistry.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c1-3-9(7-11-5-1)13-10-4-2-6-12-8-10/h1-8,13H
InChI key:InChIKey=GIARLJNYSQAXIX-UHFFFAOYSA-N
SMILES:N(C=1C=CC=NC1)C=2C=CC=NC2
Synonyms:- 3-Pyridinamine, N-3-pyridinyl-
- Pyridine, 3,3′-iminodi-
- Di(pyridin-3-yl)amine
- N-3-Pyridinyl-3-pyridinamine
- Di-3-Pyridylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

