CAS 1915-96-4

D-2,3-Diaminopropionic acid

Description:

D-2,3-Diaminopropionic acid, with the CAS number 1915-96-4, is a non-proteinogenic amino acid characterized by the presence of two amino groups (-NH2) and one carboxylic acid group (-COOH) in its structure. This compound is a stereoisomer of 2,3-diaminopropionic acid, specifically the D-form, which means it has a specific spatial arrangement of its atoms. It is typically a white crystalline solid that is soluble in water, reflecting its polar nature due to the amino and carboxyl functional groups. D-2,3-Diaminopropionic acid plays a role in various biochemical processes and is of interest in research related to peptide synthesis and the study of amino acid metabolism. Its unique structure allows it to participate in the formation of peptides and proteins, and it may also have applications in pharmaceuticals and biotechnology. Additionally, it can serve as a building block for the synthesis of more complex molecules in organic chemistry.

Formula: C₃H₈N₂O₂

InChI: InChI=1/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)

SMILES: C(C(C(=O)O)N)N

Synonyms:

• H-D-Dap-OH
• 3-Aminoalanine

D-Alanine, 3-amino-

CAS: 1915-96-4

Formula: C₃H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 104.1078

Ref: IN-DA002FAG

(R)-2,3-Diaminopropanoic acid

CAS: 1915-96-4

(R)-2,3-Diaminopropanoic acid

Purity: 95%

Molecular weight: 104.11g/mol

Ref: 54-OR82188

(R)-2,3-Diaminopropanoic acid

CAS: 1915-96-4

Formula: C₃H₈N₂O₂

Purity: 97%

Molecular weight: 104.109

Ref: 10-F226499