CAS 1915-98-6

2-Hydroxyxanthone

Description:

2-Hydroxyxanthone, with the CAS number 1915-98-6, is an organic compound belonging to the xanthone family, characterized by a fused tricyclic structure containing both aromatic and carbonyl functionalities. This compound features a hydroxyl group (-OH) at the 2-position of the xanthone ring, which contributes to its chemical reactivity and solubility properties. 2-Hydroxyxanthone is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. It is known for its potential applications in various fields, including pharmaceuticals, where it may exhibit antioxidant, anti-inflammatory, and antimicrobial properties. Additionally, 2-hydroxyxanthone can serve as a fluorescent probe in biochemical studies due to its ability to absorb and emit light. Its structural features and functional groups make it a subject of interest in organic synthesis and materials science, particularly in the development of dyes and pigments.

Formula: C₁₃H₈O₃

InChI: InChI=1S/C13H8O3/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7,14H

InChI key: InChIKey=WSACHQJPCNOREV-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=CC=CC3)=CC=C(O)C2

Synonyms:

• 2-Hydroxyxanthen-9-one
• 2-Hydroxyxanthone
• 9H-xanthen-9-one, 2-hydroxy-
• Xanthen-9-one, 2-hydroxy-
• 2-Hydroxy-9H-xanthen-9-one

9H-Xanthen-9-one, 2-hydroxy-

CAS: 1915-98-6

Formula: C₁₃H₈O₃

Color and Shape: Solid

Molecular weight: 212.2008

Ref: IN-DA002FAF

2-hydroxy-9H-9-xanthenone

CAS: 1915-98-6

2-hydroxy-9H-9-xanthenone

Purity: ≥95%

Molecular weight: 212.20g/mol

Ref: 54-OR28244

2-Hydroxyxanthone

CAS: 1915-98-6

2-Hydroxyxanthone is a inhibits Plasmodium falciparum K1, a potential inhibitor of PKCζ and MAO-A, and inhibits the proliferation of K562 cells.

Formula: C₁₃H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2

Ref: TM-TN2771

2-Hydroxyxanthone

CAS: 1915-98-6

2-Hydroxyxanthone is a bioactive compound, which is a naturally occurring xanthonoid found in various plant sources, particularly in the families Guttiferae and Gentianaceae. Its mode of action includes the modulation of enzymatic activities and pathways involved in oxidative stress and inflammation. It exhibits various biological activities such as antioxidant, anti-inflammatory, and antimicrobial effects.

Formula: C₁₃H₈O₃

Purity: Min. 95%

Molecular weight: 212.2 g/mol

Ref: 3D-BAA91598