
CAS 19150-71-1
:Octadecyl 3-oxobutanoate
Description:
Octadecyl 3-oxobutanoate, with the CAS number 19150-71-1, is an organic compound characterized by its ester functional group. It is derived from the reaction of octadecanol and 3-oxobutanoic acid, resulting in a long-chain fatty acid ester. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its hydrophobic properties, making it useful in various applications, including as a surfactant, emulsifier, or stabilizer in formulations. The presence of the long alkyl chain contributes to its low solubility in water while enhancing compatibility with organic solvents. Additionally, Octadecyl 3-oxobutanoate may exhibit thermal stability and resistance to oxidation, which are advantageous in industrial applications. Its chemical structure allows for potential use in the synthesis of more complex molecules, making it relevant in fields such as materials science and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C22H42O3
InChI:InChI=1S/C22H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-22(24)20-21(2)23/h3-20H2,1-2H3
InChI key:InChIKey=BMOMBHKAYGMGCR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)OC(CC(C)=O)=O
Synonyms:- Stearyl acetoacetate
- Octadecyl acetoacetate
- Octadecyl 3-oxobutanoate
- Butanoic acid, 3-oxo-, octadecyl ester
- Acetoacetic acid, octadecyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
