CAS 19152-36-4
:2′-Hydroxy-3,4-dimethoxychalcone
Description:
2′-Hydroxy-3,4-dimethoxychalcone is a flavonoid compound belonging to the chalcone class, characterized by its distinctive structure that includes a phenolic hydroxyl group and two methoxy groups. This compound typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond system. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The presence of the hydroxyl and methoxy groups can enhance its solubility and reactivity, influencing its interaction with biological systems. In terms of stability, chalcones can be sensitive to light and heat, which may affect their efficacy in various applications. 2′-Hydroxy-3,4-dimethoxychalcone is often studied in the context of natural product chemistry and pharmacology, where it may serve as a lead compound for the development of new therapeutic agents. Its CAS number, 19152-36-4, is a unique identifier used for regulatory and research purposes, facilitating the tracking and study of this specific chemical entity.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-20-16-10-8-12(11-17(16)21-2)7-9-15(19)13-5-3-4-6-14(13)18/h3-11,18H,1-2H3
InChI key:InChIKey=MFLSRHQHCDTOGH-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C=CC(=O)C2=C(O)C=CC=C2)=C1
Synonyms:- (2E)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one
- 2'-Hydroxy-3,4-Dimethoxychalcone
- 2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2-hydroxyphenyl)-
- 2-[3-(3,4-Dimethoxyphenyl)-2-propenoyl]phenol
- 3-(3,4-Dimethoxyphenyl)-1-(2-Hydroxyphenyl)Prop-2-En-1-One
- 3-(3,4-Dimethoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one
- 3-(3,4-Dimethoxyphenyl)-1-(2′-hydroxyphenyl)-2-propene-1-one
- Chalcone, 2′-hydroxy-3,4-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2-hydroxyphenyl)-
CAS:Formula:C17H16O4Purity:97%Color and Shape:SolidMolecular weight:284.30652'-Hydroxy-3,4-dimethoxychalcone
CAS:2'-Hydroxy-3,4-dimethoxychalconePurity:≥98%Molecular weight:284.31g/mol3-(3,4-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one
CAS:3-(3,4-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-oneFormula:C17H16O4Purity:95%Color and Shape: yellow solidMolecular weight:284.31g/mol2'-Hydroxy-3,4-dimethoxychalcone
CAS:2'-Hydroxy-3,4-dimethoxychalcone, a chalcone compound isolated from the roots of Sophora japonica, has antioxidant activity and inhibited the intracellularFormula:C17H16O4Purity:98.04%Color and Shape:SolidMolecular weight:284.31(E)-2'-Hydroxy-3,4-dimethoxychalcone
CAS:Formula:C17H16O4Purity:>98.0%(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:284.312'-Hydroxy-3,4-dimethoxychalcone
CAS:Controlled ProductFormula:C17H16O4Color and Shape:NeatMolecular weight:284.312'-Hydroxy-3,4-dimethoxychalcone
CAS:2'-Hydroxy-3,4-dimethoxychalcone is an organic compound classified as a chalcone, which is a type of flavonoid. This chalcone is typically synthesized through the Claisen-Schmidt condensation of appropriate benzaldehydes and acetophenones, often derived from plant sources or via chemical synthesis in the laboratory setting.Formula:C17H16O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:284.31 g/mol





