CAS 19152-39-7
:4'-HYDROXY-3,4-METHYLENEDIOXYCHALCONE
Description:
4'-Hydroxy-3,4-methylenedioxychalcone, with the CAS number 19152-39-7, is a flavonoid compound belonging to the chalcone class. This substance is characterized by its unique structure, which includes a hydroxyl group and a methylenedioxy moiety, contributing to its potential biological activities. It typically exhibits a yellow to orange color, which is common among chalcones due to their conjugated double bond systems. This compound is known for its antioxidant properties and has been studied for its potential anti-inflammatory and anticancer effects. Additionally, it may possess antimicrobial activity, making it of interest in pharmaceutical and nutraceutical applications. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methylenedioxy group can influence its reactivity and interaction with biological targets. Overall, 4'-hydroxy-3,4-methylenedioxychalcone represents a significant compound in the field of natural products and medicinal chemistry, warranting further investigation into its therapeutic potential.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c17-13-5-3-12(4-6-13)14(18)7-1-11-2-8-15-16(9-11)20-10-19-15/h1-9,17H,10H2/b7-1+
Synonyms:- Timtec-Bb Sbb002402
- 3-(1,3-Benzodioxol-5-Yl)-1-(4-Hydroxyphenyl)-2-Propen-1-One
- (2E)-3-(1,3-benzodioxol-5-yl)-1-(4-hydroxyphenyl)prop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Benzo[d][1,3]dioxol-5-yl)-1-(4-hydroxyphenyl)prop-2-en-1-one
CAS:Formula:C16H12O4Molecular weight:268.26414'-Hydroxy-3,4-(methylenedioxy)chalcone
CAS:4'-Hydroxy-3,4-(methylenedioxy)chalconePurity:≥95%Molecular weight:268.26g/mol4'-Hydroxy-3,4-methylenedioxychalcone
CAS:4'-Hydroxy-3,4-methylenedioxychalcone is a reaction component that belongs to the category of fine chemicals. It is a useful scaffold for the synthesis of complex compounds and can be used as a reagent for the preparation of other chemical substances. 4'-Hydroxy-3,4-methylenedioxychalcone is an intermediate in the manufacture of certain drugs such as taxol, which is used to treat breast cancer. The CAS number for this substance is 19152-39-7.Formula:C16H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:268.26 g/mol


