CAS 191532-23-7: 2-Acetamido-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-2-deoxy-D-glucopyranose
Description:2-Acetamido-3-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-2-deoxy-D-glucopyranose is a complex carbohydrate derivative, specifically a glycoside, that features both amino and acetyl functional groups. This compound is characterized by its structural components, which include a glucopyranose backbone modified with an acetamido group at the 2-position and a tetra-acetylated galactopyranosyl moiety at the 3-position. The presence of multiple acetyl groups enhances its solubility and stability, making it suitable for various biochemical applications. This compound is often studied in the context of glycoscience and can serve as a substrate or intermediate in the synthesis of more complex oligosaccharides or glycoproteins. Its CAS number, 191532-23-7, allows for precise identification in chemical databases. Overall, this substance exemplifies the intricate nature of carbohydrate chemistry and its potential applications in medicinal chemistry and biochemistry.
Formula:C22H33NO15
InChI:InChI=1/C22H33NO15/c1-8(25)23-15-18(16(30)13(6-24)36-21(15)31)38-22-20(35-12(5)29)19(34-11(4)28)17(33-10(3)27)14(37-22)7-32-9(2)26/h13-22,24,30-31H,6-7H2,1-5H3,(H,23,25)/t13?,14?,15-,16+,17-,18?,19-,20-,21+,22-/m0/s1

D-Glucose, 2-(acetylamino)-2-deoxy-3-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-
Ref: IN-DA002FAS
Undefined size | To inquire |

2-Acetamido-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-2-deoxy-D-glucopyranose
Ref: 7W-GC6449
Undefined size | To inquire |

2-Acetamido-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-2-deoxy-D-glucopyranose
Ref: 3D-OA04455
10mg | 347.00 € | ||
50mg | 1,011.00 € | ||
100mg | 1,588.00 € |