CAS 191546-96-0: 3,4,10,14b-Tetrahydro-2-methylpyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-1(2H)-one
Description:3,4,10,14b-Tetrahydro-2-methylpyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-1(2H)-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrazine and benzazepine moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a methyl group that contributes to its overall molecular diversity. The presence of nitrogen atoms within the pyrazino and pyrido rings suggests potential biological activity, as nitrogen-containing compounds often exhibit pharmacological properties. The compound's molecular structure may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the specific arrangement of functional groups can affect its interaction with biological targets, potentially leading to therapeutic applications. As with many complex organic molecules, understanding its characteristics requires consideration of its stereochemistry, electronic properties, and potential for forming hydrogen bonds, which can all play significant roles in its behavior in various chemical environments.
Formula:C17H17N3O
InChI:InChI=1S/C17H17N3O/c1-19-9-10-20-15(17(19)21)14-7-3-2-5-12(14)11-13-6-4-8-18-16(13)20/h2-8,15H,9-11H2,1H3
InChI key:InChIKey=NWXITVQAKIFZLZ-UHFFFAOYSA-N
SMILES:O=C1N(C)CCN2C3=NC=CC=C3CC=4C=CC=CC4C12
- Synonyms:
- 3,4,10,14b-Tetrahydro-2-methylpyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-1(2H)-one
- Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-1(2H)-one, 3,4,10,14b-tetrahydro-2-methyl-

Mirtazapine Related Compound C (2-Methyl-3,4,10,14b-tetrahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepin-1(2H)-one)
Ref: 45-1444241
50mg | 1,477.00 € |

Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepin-1(2H)-one, 3,4,10,14b-tetrahydro-2-methyl-
Ref: IN-DA002FBF
Undefined size | To inquire |

Mirtazapine EP Impurity C (Mirtazapine USP Related Compound C)
Ref: 4Z-M-1010
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

1-Oxo Mirtazapine (Mirtazapine Impurity C)
Ref: TR-O857990
5mg | 1,252.00 € |

1-Oxo mirtazapine
Ref: 3D-IO26654
1mg | 818.00 € | ||
2mg | 1,186.00 € | ||
5mg | 1,897.00 € | ||
10mg | 3,579.00 € | ||
500µg | 531.00 € |