CAS 19155-24-9

3,3-dimethyl-1,3-dihydro-2H-indol-2-one

Description:

3,3-Dimethyl-1,3-dihydro-2H-indol-2-one, with the CAS number 19155-24-9, is an organic compound that belongs to the indole family. It features a bicyclic structure characterized by a fused indole ring system, which contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its relatively low solubility in water, but it may dissolve in organic solvents such as ethanol or acetone. The presence of the dimethyl groups enhances its lipophilicity, potentially influencing its biological activity. 3,3-Dimethyl-1,3-dihydro-2H-indol-2-one may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, this compound may undergo typical organic reactions, such as oxidation or substitution, depending on the functional groups present. Overall, its unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₀H₁₁NO

InChI: InChI=1/C10H11NO/c1-10(2)7-5-3-4-6-8(7)11-9(10)12/h3-6H,1-2H3,(H,11,12)

SMILES: CC1(C)c2ccccc2N=C1O

Synonyms:

• 2H-Indol-2-one, 1,3-dihydro-3,3-dimethyl-
• 3,3-Dimethylindolin-2-one
• 3,3-Dimethyl-1,3-Dihydro-Indol-2-One

2H-Indol-2-one, 1,3-dihydro-3,3-dimethyl-

CAS: 19155-24-9

Formula: C₁₀H₁₁NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.2004

Ref: IN-DA002FBY

3,3-Dimethylindolin-2-one

CAS: 19155-24-9

3,3-Dimethylindolin-2-one

Formula: C₁₀H₁₁NO

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 161.20g/mol

Ref: 54-OR964406

3,3-Dimethylindolin-2-one

CAS: 19155-24-9

Formula: C₁₀H₁₁NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.204

Ref: 10-F078211

3,3-Dimethyloxindole

Controlled Product

CAS: 19155-24-9

Formula: C₁₀H₁₁NO

Color and Shape: Neat

Molecular weight: 161.2

Ref: TR-D476405