CAS 19155-88-5
:2,1,3-Benzoxadiazole-5-carboxylic acid
Description:
2,1,3-Benzoxadiazole-5-carboxylic acid is an organic compound characterized by its bicyclic structure, which includes a benzene ring fused to a 1,3-benzodiazole moiety. This compound features a carboxylic acid functional group at the 5-position of the benzoxadiazole ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of fluorescent dyes and as a building block in organic synthesis. Additionally, the compound may exhibit interesting photophysical properties, making it useful in optoelectronic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C7H4N2O3
InChI:InChI=1S/C7H4N2O3/c10-7(11)4-1-2-5-6(3-4)9-12-8-5/h1-3H,(H,10,11)
InChI key:InChIKey=WZUFYJFTOVGJJT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(C=C1)=NON2
Synonyms:- 1,2,3-Benzoxadiazole-5-carboxylicacid
- 2,1,3-Benzoxadiazole-5-Carboxylate
- 2,1,3-Benzoxadiazole-5-Carboxylic acid, HPLC 97%
- 5-Benzofurazancarboxylic acid
- Benzo[1,2,5]oxadiazole-5-carboxylic acid
- Benzo[2,1,3]oxadiazole-5-carboxylic acid
- Benzo[c][1,2,5]oxadiazole-5-carboxylic acid
- Benzofurazan-5-Carboxylic Acid
- Buttpark 29\08-25
- Rarechem Al Bo 0811
- 2,1,3-Benzoxadiazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,1,3-Benzoxadiazole-5-carboxylic acid
CAS:Formula:C7H4N2O3Purity:98%Color and Shape:SolidMolecular weight:164.11832,1,3-Benzoxadiazole-5-carboxylic acid
CAS:2,1,3-Benzoxadiazole-5-carboxylic acidFormula:C7H4N2O3Purity:97%Color and Shape: yellow powderMolecular weight:164.12g/molBenzofurazan-5-carboxylic acid
CAS:Formula:C7H4N2O3Purity:98%Color and Shape:SolidMolecular weight:164.122,1,3-Benzoxadiazole-5-carboxylic acid
CAS:2,1,3-Benzoxadiazole-5-carboxylic acid is a functional theory that is an agonist of the opioid receptors. It is also a quaternary ammonium salt that has been shown to cause respiratory depression and death in mice. This drug is used as an anion in pentobarbital sodium, which has been linked to overdoses. 2,1,3-Benzoxadiazole-5-carboxylic acid can be activated by membrane proteins and other agents to increase its energy efficiency. It can also enhance the effect of molecules such as coulombic forces and depression.Formula:C7H4N2O3Purity:Min. 95%Molecular weight:164.12 g/mol



