CAS 191595-63-8

2-HYDROXY-6-(TRIFLUOROMETHYL)NICOTINICACID

Description:

2-Hydroxy-6-(trifluoromethyl)nicotinic acid, with the CAS number 191595-63-8, is a chemical compound that belongs to the class of nicotinic acids, which are derivatives of pyridine. This compound features a hydroxyl group (-OH) and a trifluoromethyl group (-CF3) attached to the pyridine ring, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. The hydroxyl group contributes to its acidity and potential for hydrogen bonding, which can impact solubility and interaction with biological targets. Typically, compounds like this are studied for their potential applications in medicinal chemistry, particularly in the development of drugs targeting various diseases. Additionally, the unique combination of functional groups may impart specific characteristics such as increased stability or altered metabolic pathways. Overall, 2-hydroxy-6-(trifluoromethyl)nicotinic acid represents a valuable compound for further exploration in both synthetic and medicinal chemistry contexts.

Formula: C₇H₄F₃NO₃

InChI: InChI=1/C7H4F3NO3/c8-7(9,10)4-2-1-3(6(13)14)5(12)11-4/h1-2H,(H,11,12)(H,13,14)

SMILES: c1cc(C(F)(F)F)nc(c1C(=O)O)O

Synonyms:

• 3-carboxyl-6-trifluoromethyl-1H-pyridin-2-one
• 2-Hydroxy-6-triflroromethylnicotinic acid
• 2-Hydroxy-6-(Trifluoromethyl)Pyridine-3-Carboxylic Acid
• 2-Hydroxy-6-(trifluoromethyl)nicotinic acid
• 2-Hydroxy-6-triflroromethyl-3-pyridinecarboxylic acid

2-Hydroxy-6-(trifluoromethyl)nicotinic acid

CAS: 191595-63-8

Formula: C₇H₄F₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.1068

Ref: IN-DA0038WK

2-Hydroxy-6-(trifluoromethyl)nicotinic acid

CAS: 191595-63-8

2-Hydroxy-6-(trifluoromethyl)nicotinic acid

Purity: 98%

Color and Shape: Yellow-Tan Solid

Molecular weight: 207.11g/mol

Ref: 54-PC1877

2-Hydroxy-6-(trifluoromethyl)nicotinic acid

CAS: 191595-63-8

Formula: C₇H₄F₃NO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 207.108

Ref: 10-F009268