CAS 1916-10-5

3,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-2-ol

Description:

3,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-2-ol, with the CAS number 1916-10-5, is a complex organic compound belonging to the isoquinoline family. This substance features a fused bicyclic structure that incorporates both isoquinoline and isoquinolinol moieties, characterized by the presence of multiple methoxy (-OCH3) groups, which enhance its solubility and reactivity. The compound exhibits a range of biological activities, often studied for its potential pharmacological properties, including antioxidant and anti-inflammatory effects. Its unique structural features contribute to its ability to interact with various biological targets, making it of interest in medicinal chemistry. The presence of the hydroxyl group (-OH) in the isoquinolinol part of the molecule can also influence its chemical reactivity and biological interactions. Overall, 3,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-2-ol represents a significant compound for research in both synthetic and medicinal chemistry contexts.

Formula: C₂₀H₂₁NO₄

InChI: InChI=1/C20H21NO4/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,8-11,16,22H,6-7H2,1-3H3

SMILES: COc1ccc2=CC3c4cc(c(cc4CCN3C=c2c1OC)OC)O

Columbamine Chloride

CAS: 1916-10-5

Formula: C₂₀H₂₀NO₄·Cl

Molecular weight: 338.38 35.45

Ref: 4Z-C-174001

Columbamine chloride

CAS: 1916-10-5

Natural alkaloid

Formula: C₂₀H₂₀NO₄Cl

Purity: ≥ 98.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 373.83

Ref: 5G-22604

Columbamine chloride

CAS: 1916-10-5

Columbamine chloride is an alkaloid compound, which is a synthetic derivative known for its relevance in biochemical and pharmacological research. This compound is derived from plant sources, primarily found in specific species within the Berberidaceae family. It functions by interacting with cellular pathways, influencing various cellular processes through its effects on signaling pathways and enzyme activity.

Formula: C₂₀H₂₀NO₄•Cl

Purity: Min. 98%

Color and Shape: Powder

Molecular weight: 373.83 g/mol

Ref: 3D-FC74185