CAS 191605-10-4
:(S,S)-Di-p-anisoyltartaric acid
Description:
(S,S)-Di-p-anisoyltartaric acid is a chiral compound that belongs to the class of tartaric acid derivatives. It is characterized by the presence of two p-anisoyl groups attached to the tartaric acid backbone, which contributes to its stereochemical properties. This compound is typically utilized in asymmetric synthesis and as a chiral auxiliary in various chemical reactions, particularly in the production of enantiomerically pure compounds. The presence of the p-anisoyl groups enhances its solubility in organic solvents, making it suitable for various applications in organic chemistry. Additionally, (S,S)-Di-p-anisoyltartaric acid exhibits specific optical activity due to its chiral nature, allowing it to interact differently with polarized light. Its ability to form stable complexes with metal ions further expands its utility in catalysis and material science. Overall, this compound is significant in the field of stereochemistry and plays a crucial role in the development of chiral drugs and other fine chemicals.
Formula:C20H18O10
InChI:InChI=1S/C20H18O10/c1-27-13-7-3-11(4-8-13)19(25)29-15(17(21)22)16(18(23)24)30-20(26)12-5-9-14(28-2)10-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m0/s1
InChI key:InChIKey=KWWCVCFQHGKOMI-HOTGVXAUSA-N
SMILES:[C@@H]([C@H](OC(=O)C1=CC=C(OC)C=C1)C(O)=O)(OC(=O)C2=CC=C(OC)C=C2)C(O)=O
Synonyms:- (2S,3S)-(+)-Di(p-anisoyl)tartaric acid
- (2S,3S)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid
- (S,S)-Di-p-anisoyltartaric acid
- 2,3-Bis[(4-Methoxybenzoyl)Oxy]Butanedioic Acid
- Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)-
- Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, [S-(R*,R*)]-
- Di(+)-(p-anisoyl)-<span class="text-smallcaps">D</span>-tartrate
- Di-P-Anisoyl-D-Tartaric Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(+)-Di-p-anisoyl-D-tartaric Acid
CAS:Formula:C20H18O10Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:418.35Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)-
CAS:Formula:C20H18O10Purity:98%Color and Shape:SolidMolecular weight:418.3509Ref: IN-DA002FCY
5g22.00€10g26.00€25g28.00€50g38.00€100g56.00€10kgTo inquire25kgTo inquire500g139.00€50kgTo inquire(2S,3S)-2,3-Bis((4-methoxybenzoyl)oxy)succinic acid
CAS:(2S,3S)-2,3-Bis((4-methoxybenzoyl)oxy)succinic acidPurity:98%Color and Shape:Pale Yellow SolidMolecular weight:418.35g/molDibenzoyl-(+)-p-methoxy-D-tartaric acid
CAS:<p>Dibenzoyl-(+)-p-methoxy-D-tartaric acid is a macrocyclic molecule that has been synthesized as an enantiomer. It has been found to be an effective drug against schistosomiasis in experimental studies. The compound inhibits the growth of Schistosoma mansoni by preventing the formation of eggs, which are released by the female worms into the environment. Dibenzoyl-(+)-p-methoxy-D-tartaric acid also inhibits the development of larval stages and prevents the release of eggs from male worms. This drug is not yet used clinically for this purpose, but it is being researched for use in tropical regions where schistosomiasis is endemic.</p>Formula:C20H18O10Purity:Min. 95%Color and Shape:White PowderMolecular weight:418.35 g/mol






