CymitQuimica logo

CAS 191614-02-5

:

5-Fluoro-1,3-dimethyl-1H-pyrazole-4-carbonyl fluoride

Description:
5-Fluoro-1,3-dimethyl-1H-pyrazole-4-carbonyl fluoride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a fluorine atom at the 5-position and a carbonyl fluoride functional group at the 4-position contributes to its reactivity and potential applications in various chemical processes. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to act as a building block in the development of more complex molecules. Its molecular structure suggests that it may exhibit specific biological activities, making it of interest in medicinal chemistry. Additionally, the carbonyl fluoride group indicates that it may participate in nucleophilic reactions, which can be exploited in synthetic pathways. As with many fluorinated compounds, it may also exhibit unique physical properties, such as increased stability and altered solubility compared to its non-fluorinated counterparts. Proper handling and storage are essential due to its potential reactivity and the presence of hazardous functional groups.
Formula:C6H6F2N2O
InChI:InChI=1S/C6H6F2N2O/c1-3-4(6(8)11)5(7)10(2)9-3/h1-2H3
InChI key:InChIKey=FSLWXANTEMFPRQ-UHFFFAOYSA-N
SMILES:C(F)(=O)C1=C(F)N(C)N=C1C
Synonyms:
  • 1H-Pyrazole-4-carbonyl fluoride, 5-fluoro-1,3-dimethyl-
  • 5-Fluoro-1,3-dimethyl-1H-pyrazole-4-carbonyl fluoride
  • 1,3-Dimethyl-5-fluoropyrazole-4-carbonyl fluoride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.