CAS 19165-11-8

isopropyl B-D-thioglucopyranoside

Description:

Isopropyl B-D-thioglucopyranoside is a chemical compound characterized by its structure as a thioglycoside, which features a thiol group (-SH) attached to a sugar moiety, specifically a glucopyranoside. This compound is typically used in biochemical applications, particularly in the study of glycosylation processes and as a substrate for glycosidases. It is soluble in water and organic solvents, making it versatile for various laboratory settings. The presence of the isopropyl group enhances its stability and solubility compared to other thioglycosides. Isopropyl B-D-thioglucopyranoside is often employed in synthetic organic chemistry and biochemistry for its ability to participate in glycosylation reactions, facilitating the formation of glycosidic bonds. Additionally, it can serve as a protective group in carbohydrate chemistry. Safety data indicates that, like many thiol-containing compounds, it should be handled with care due to potential reactivity and toxicity. Overall, its unique properties make it a valuable tool in carbohydrate chemistry and related fields.

Formula: C₉H₁₈O₅S

InChI: InChI=1/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3

SMILES: CC(C)SC1C(C(C(C(CO)O1)O)O)O

Synonyms:

• Propan-2-Yl 1-Thiohexopyranoside

β-D-Glucopyranoside, 1-methylethyl 1-thio-

CAS: 19165-11-8

Formula: C₉H₁₈O₅S

Purity: 95%

Molecular weight: 238.3012

Ref: IN-DA002FEO

Isopropyl 1-thio-β-D-glucopyranoside

CAS: 19165-11-8

Isopropyl 1-thio-β-D-glucopyranoside

Molecular weight: 238.30122g/mol

Ref: 54-BICL2333

Isopropyl β-D-thioglucopyranoside

CAS: 19165-11-8

Formula: C₉H₁₈O₅S

Molecular weight: 238.30

Ref: 7W-GC4395

Isopropyl-β-D-thioglucopyranoside

CAS: 19165-11-8

Isopropyl-β-D-thioglucopyranoside is a hydrogen bond donor that has been shown to inhibit the glyceraldehyde-3-phosphate dehydrogenase enzyme, which is involved in lipid biosynthesis. It has been used for the diagnosis of malariae and has potential as a biomarker for diagnosing human tissues. Isopropyl-β-D-thioglucopyranoside may be useful in the study of protein synthesis, due to its ability to bind to recombinant proteins and block the formation of intermolecular hydrogen bonds. Isopropyl-β-D-thioglucopyranoside is also expressed at high levels in Mycobacterium tuberculosis strains (e.g., ESX-1 secretion system protein) and inhibits cell growth in culture.

Formula: C₉H₁₈O₅S

Purity: Min 95%

Color and Shape: Powder

Molecular weight: 238.3 g/mol

Ref: 3D-MI08971

Isopropyl-β-D-thioglucopyranoside

CAS: 19165-11-8

Isopropyl-beta-D-thioglucopyranoside is a carbohydrate derivative that has the same chemical formula as glucose but with a different spatial arrangement. It is also known as beta-D-thioglucose or thioisopropylglucose, and it is an intermolecular hydrogen bond donor and acceptor. Isopropyl-beta-D-thioglucopyranoside absorbs light at wavelengths of 265 nm, 280 nm, and 320 nm. Carbohydrates are compounds containing carbon, hydrogen and oxygen atoms in a ratio of 1:2:1 by weight, with the general formula CHON. They consist of many isomers that differ from each other in the configurations of their carbonyl group and hydroxyl group. The molecular system for isopropyl-beta-D-thioglucopyranoside consists of one molecule with two hydrogen bonds to two other molecules.

Formula: C₉H₁₈O₅S

Molecular weight: 238.3 g/mol

Ref: 3D-I-8200