
CAS 19169-97-2
:Bis(acetato-κO)(3-methylphenyl)iodine
Description:
Bis(acetato-κO)(3-methylphenyl)iodine, with the CAS number 19169-97-2, is an organoiodine compound characterized by its iodine atom bonded to a 3-methylphenyl group and two acetate groups. This compound typically exhibits a pale yellow to orange color and is known for its role as an oxidizing agent in organic synthesis. The presence of the iodine atom allows for electrophilic reactivity, making it useful in various chemical transformations, including iodination reactions. The acetate groups contribute to its solubility in organic solvents and can influence its reactivity and stability. Additionally, the 3-methylphenyl substituent can affect the electronic properties of the molecule, potentially enhancing its reactivity. Bis(acetato-κO)(3-methylphenyl)iodine is often utilized in synthetic organic chemistry for the introduction of iodine into organic molecules and can serve as a reagent in the synthesis of various functionalized compounds. Safety precautions should be observed when handling this compound due to its reactive nature.
Formula:C11H13IO4
InChI:InChI=1S/C11H13IO4/c1-8-5-4-6-11(7-8)12(15-9(2)13)16-10(3)14/h4-7H,1-3H3
InChI key:InChIKey=GYZBFMJVJGCOQB-UHFFFAOYSA-N
SMILES:I(OC(C)=O)(OC(C)=O)C1=CC(C)=CC=C1
Synonyms:- Toluene, m-(diacetoxyiodo)-
- Benzene, methyl-, iodine complex
- Iodine, bis(acetato-O)(3-methylphenyl)-
- Toluene, m-(dihydroxyiodo)-, diacetate
- Iodine, bis(acetato-κO)(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Iodine, bis(acetato-O)(3-methylphenyl)-
CAS:<p>Iodine, bis(acetato-O)(3-methylphenyl)- (9CI) is a bioactive chemical.</p>Formula:C11H13IO4Color and Shape:SolidMolecular weight:336.125

