CAS 1917-15-3
:5-Methyl-2-furoic acid
Description:
5-Methyl-2-furoic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group (-COOH) and a methyl group (-CH3) attached to the furan ring, specifically at the 5 and 2 positions, respectively. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 5-Methyl-2-furoic acid is soluble in polar solvents like water and alcohols, making it versatile for various applications in organic synthesis and as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, its unique structure may contribute to specific biological activities, although detailed studies on its biological properties are limited. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H5O3
InChI:InChI=1/C6H6O3/c1-4-2-3-5(9-4)6(7)8/h2-3H,1H3,(H,7,8)/p-1
SMILES:Cc1ccc(C(=O)[O-])o1
Synonyms:- 2-Furancarboxylic acid, 5-methyl-
- 5-Methylpyromucic acid
- 5-Methylfuran-2-Carboxylic Acid
- 5-Methylfuran-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Furancarboxylic acid, 5-methyl-
CAS:Formula:C6H6O3Purity:97%Color and Shape:SolidMolecular weight:126.1100Ref: IN-DA002FFC
1g26.00€5g44.00€10g65.00€25g127.00€100g282.00€250gTo inquire500gTo inquire250mg22.00€5-Methylfuran-2-carboxylic acid
CAS:5-Methylfuran-2-carboxylic acid is a furan derivative widely used in biochemical experiments and drug synthesis research.Formula:C6H6O3Purity:99.89%Color and Shape:SolidMolecular weight:126.115-Methyl-2-furoic acid
CAS:5-Methyl-2-furoic acidFormula:C6H6O3Purity:97%Color and Shape: brown solidMolecular weight:126.11003g/mol5-Methylfuran-2-carboxylic Acid
CAS:Controlled ProductFormula:C6H6O3Color and Shape:NeatMolecular weight:126.115-Methyl-furan-2-carboxylic acid
CAS:Formula:C6H6O3Purity:97%Color and Shape:SolidMolecular weight:126.111





