CAS 1917-60-8

5-(METHOXYMETHYL)-2-FUROIC ACID

Description:

5-(Methoxymethyl)-2-furoic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a methoxymethyl group and a carboxylic acid functional group, contributing to its reactivity and solubility in polar solvents. The presence of the methoxymethyl group enhances its potential for various chemical reactions, including esterification and nucleophilic substitutions. As a furoic acid derivative, it may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's molecular structure allows for hydrogen bonding, which can influence its physical properties, such as melting point and solubility. Additionally, its unique functional groups may impart specific characteristics, such as acidity and the ability to participate in various chemical transformations. Overall, 5-(methoxymethyl)-2-furoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₈O₄

InChI: InChI=1/C7H8O4/c1-10-4-5-2-3-6(11-5)7(8)9/h2-3H,4H2,1H3,(H,8,9)

SMILES: COCc1ccc(C(=O)O)o1

Synonyms:

• 2-Furancarboxylic Acid, 5-(Methoxymethyl)-
• 5-(Methoxymethyl)Furan-2-Carboxylic Acid
• 5-(methoxymethyl)-2-furoic acid

2-Furancarboxylic acid, 5-(methoxymethyl)-

CAS: 1917-60-8

Formula: C₇H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.1360

Ref: IN-DA002FG3

5-(Methoxymethyl)furan-2-carboxylic acid

CAS: 1917-60-8

5-(Methoxymethyl)furan-2-carboxylic acid

Purity: 99%

Molecular weight: 156.14g/mol

Ref: 54-OR94519

5-(Methoxymethyl)-2-furoic acid

CAS: 1917-60-8

Formula: C₇H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.137

Ref: 10-F300443

5-Methoxymethyl-furan-2-carboxylic acid

CAS: 1917-60-8

5-Methoxymethyl-furan-2-carboxylic acid is a heterocycle that is sensitive to light, heat, and moisture. It reacts with chlorides and forms a yellow precipitate. This chemical also has an organic acid nature, a constant of 4.03 g/mol, and phosphonates interactions. 5-Methoxymethyl-furan-2-carboxylic acid is soluble in water and reacts with the chromatographic parameters of the column. The compound can be identified by its chromatogram peaks at 0.7 minutes on the time axis and at 2.8 minutes on the time axis.

Formula: C₇H₈O₄

Purity: Min. 95%

Molecular weight: 156.14 g/mol

Ref: 3D-BAA91760