CymitQuimica logo

CAS 191725-82-3

:

Ethanone, 1-(4-methoxy-3-pyridinyl)- (9CI)

Description:
Ethanone, 1-(4-methoxy-3-pyridinyl)-, also known by its CAS number 191725-82-3, is an organic compound characterized by its ketone functional group and a pyridine ring substituted with a methoxy group. This compound typically exhibits a molecular structure that includes a carbonyl group (C=O) adjacent to a pyridine moiety, which contributes to its chemical reactivity and potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. Ethanone derivatives often exhibit various pharmacological properties, making them of interest in medicinal chemistry. The compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. Its synthesis may involve standard organic reactions such as acylation or substitution, and it can be analyzed using techniques like NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-6(10)7-5-9-4-3-8(7)11-2/h3-5H,1-2H3
InChI key:NTAMQFNLCLRRDR-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=CN=C1)OC
Found 3 products.